4-[(2,5-dibromobenzoyl)amino]benzoic acid

C14H9Br2NO3 — CID 114367797

IUPAC4-[(2,5-dibromobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1
InChIInChI=1S/C14H9Br2NO3/c15-9-3-6-12(16)11(7-9)13(18)17-10-4-1-8(2-5-10)14(19)20/h1-7H,(H,17,18)(H,19,20)
InChIKeyBNKWSWROXYVQEP-UHFFFAOYSA-N
MW399.04 g/mol
LogP4.16
Rot. Bonds3

About 4-[(2,5-dibromobenzoyl)amino]benzoic acid

4-[(2,5-dibromobenzoyl)amino]benzoic acid (PubChem CID 114367797) has the molecular formula C14H9Br2NO3 and a molecular weight of 399.04 g/mol. Its IUPAC name is 4-[(2,5-dibromobenzoyl)amino]benzoic acid.

Molecular Properties

Compound Name4-[(2,5-dibromobenzoyl)amino]benzoic acid
PubChem CID114367797
Molecular FormulaC14H9Br2NO3
Molecular Weight399.04 g/mol
Exact Mass396.89
IUPAC Name4-[(2,5-dibromobenzoyl)amino]benzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1
InChIInChI=1S/C14H9Br2NO3/c15-9-3-6-12(16)11(7-9)13(18)17-10-4-1-8(2-5-10)14(19)20/h1-7H,(H,17,18)(H,19,20)
InChIKeyBNKWSWROXYVQEP-UHFFFAOYSA-N
XLogP4.16
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500399.04
LogP ≤ 54.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,5-dibromobenzoyl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dibromobenzoyl)amino]benzoic acid?
The IUPAC name of 4-[(2,5-dibromobenzoyl)amino]benzoic acid (CID 114367797) is 4-[(2,5-dibromobenzoyl)amino]benzoic acid.
What is the SMILES notation for 4-[(2,5-dibromobenzoyl)amino]benzoic acid?
The canonical SMILES for 4-[(2,5-dibromobenzoyl)amino]benzoic acid is O=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1.
What is the InChIKey of 4-[(2,5-dibromobenzoyl)amino]benzoic acid?
The InChIKey is BNKWSWROXYVQEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br2NO3/c15-9-3-6-12(16)11(7-9)13(18)17-10-4-1-8(2-5-10)14(19)20/h1-7H,(H,17,18)(H,19,20).
What are the key properties of 4-[(2,5-dibromobenzoyl)amino]benzoic acid?
4-[(2,5-dibromobenzoyl)amino]benzoic acid has a molecular weight of 399.04 g/mol, XLogP of 4.16, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dibromobenzoyl)amino]benzoic acid is sourced from PubChem (CID 114367797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).