4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid

C14H8Br2FNO3 — CID 107793046

IUPAC4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1F
InChIInChI=1S/C14H8Br2FNO3/c15-7-1-4-11(16)10(5-7)13(19)18-8-2-3-9(14(20)21)12(17)6-8/h1-6H,(H,18,19)(H,20,21)
InChIKeyJJJSHWDILIDHQF-UHFFFAOYSA-N
MW417.03 g/mol
LogP4.30
Rot. Bonds3

About 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid

4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid (PubChem CID 107793046) has the molecular formula C14H8Br2FNO3 and a molecular weight of 417.03 g/mol. Its IUPAC name is 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid.

Molecular Properties

Compound Name4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid
PubChem CID107793046
Molecular FormulaC14H8Br2FNO3
Molecular Weight417.03 g/mol
Exact Mass414.89
IUPAC Name4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid
SMILESO=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1F
InChIInChI=1S/C14H8Br2FNO3/c15-7-1-4-11(16)10(5-7)13(19)18-8-2-3-9(14(20)21)12(17)6-8/h1-6H,(H,18,19)(H,20,21)
InChIKeyJJJSHWDILIDHQF-UHFFFAOYSA-N
XLogP4.30
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500417.03
LogP ≤ 54.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid?
The IUPAC name of 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid (CID 107793046) is 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid.
What is the SMILES notation for 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid?
The canonical SMILES for 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid is O=C(O)c1ccc(NC(=O)c2cc(Br)ccc2Br)cc1F.
What is the InChIKey of 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid?
The InChIKey is JJJSHWDILIDHQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8Br2FNO3/c15-7-1-4-11(16)10(5-7)13(19)18-8-2-3-9(14(20)21)12(17)6-8/h1-6H,(H,18,19)(H,20,21).
What are the key properties of 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid?
4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid has a molecular weight of 417.03 g/mol, XLogP of 4.30, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2,5-dibromobenzoyl)amino]-2-fluorobenzoic acid is sourced from PubChem (CID 107793046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).