C17H20O4 — CID 123805811
(2,3-dihydroxyphenyl) adamantane-1-carboxylate (PubChem CID 123805811) has the molecular formula C17H20O4 and a molecular weight of 288.34 g/mol. Its IUPAC name is (2,3-dihydroxyphenyl) adamantane-1-carboxylate.
| Compound Name | (2,3-dihydroxyphenyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 123805811 |
| Molecular Formula | C17H20O4 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | (2,3-dihydroxyphenyl) adamantane-1-carboxylate |
| SMILES | O=C(Oc1cccc(O)c1O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20O4/c18-13-2-1-3-14(15(13)19)21-16(20)17-7-10-4-11(8-17)6-12(5-10)9-17/h1-3,10-12,18-19H,4-9H2 |
| InChIKey | LQGOPGHTVQOXDG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|