C20H26N2O3 — CID 95041471
N-[(E)-1-(1-adamantyl)ethylideneamino]-2-hydroxy-3-methoxybenzamide (PubChem CID 95041471) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[(E)-1-(1-adamantyl)ethylideneamino]-2-hydroxy-3-methoxybenzamide.
| Compound Name | N-[(E)-1-(1-adamantyl)ethylideneamino]-2-hydroxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 95041471 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[(E)-1-(1-adamantyl)ethylideneamino]-2-hydroxy-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N/N=C(\C)C23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C20H26N2O3/c1-12(20-9-13-6-14(10-20)8-15(7-13)11-20)21-22-19(24)16-4-3-5-17(25-2)18(16)23/h3-5,13-15,23H,6-11H2,1-2H3,(H,22,24)/b21-12+ |
| InChIKey | ZXRHEBPOXSBFPI-CIAFOILYSA-N |
| XLogP | 3.72 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|