C18H18ClNO2 — CID 98620791
(2-cyanophenyl) (5R,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 98620791) has the molecular formula C18H18ClNO2 and a molecular weight of 315.80 g/mol. Its IUPAC name is (2-cyanophenyl) (5R,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (2-cyanophenyl) (5R,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98620791 |
| Molecular Formula | C18H18ClNO2 |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2-cyanophenyl) (5R,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | N#Cc1ccccc1OC(=O)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H18ClNO2/c19-18-8-12-5-13(9-18)7-17(6-12,11-18)16(21)22-15-4-2-1-3-14(15)10-20/h1-4,12-13H,5-9,11H2/t12-,13-,17?,18?/m1/s1 |
| InChIKey | RROYKAJGFOWLBL-LGBHXNNWSA-N |
| XLogP | 4.04 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|