C17H18Cl2O2 — CID 8766053
(3-chlorophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 8766053) has the molecular formula C17H18Cl2O2 and a molecular weight of 325.23 g/mol. Its IUPAC name is (3-chlorophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | (3-chlorophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 8766053 |
| Molecular Formula | C17H18Cl2O2 |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | (3-chlorophenyl) (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | O=C(Oc1cccc(Cl)c1)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C17H18Cl2O2/c18-13-2-1-3-14(5-13)21-15(20)16-6-11-4-12(7-16)9-17(19,8-11)10-16/h1-3,5,11-12H,4,6-10H2/t11-,12+,16?,17? |
| InChIKey | NVAARTHMDMFSKQ-GKUGFIGPSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|