C18H20Cl2N2O2 — CID 7742380
(5S,7R)-3-chloro-N'-(3-chlorobenzoyl)adamantane-1-carbohydrazide (PubChem CID 7742380) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N'-(3-chlorobenzoyl)adamantane-1-carbohydrazide.
| Compound Name | (5S,7R)-3-chloro-N'-(3-chlorobenzoyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 7742380 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (5S,7R)-3-chloro-N'-(3-chlorobenzoyl)adamantane-1-carbohydrazide |
| SMILES | O=C(NNC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20Cl2N2O2/c19-14-3-1-2-13(5-14)15(23)21-22-16(24)17-6-11-4-12(7-17)9-18(20,8-11)10-17/h1-3,5,11-12H,4,6-10H2,(H,21,23)(H,22,24)/t11-,12+,17?,18? |
| InChIKey | ASCSCBUGFLOWCR-CCHVVGMOSA-N |
| XLogP | 3.68 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|