C23H33ClN2O2 — CID 23375813
(5S,7S)-N'-[2-(1-adamantyl)acetyl]-3-chloroadamantane-1-carbohydrazide (PubChem CID 23375813) has the molecular formula C23H33ClN2O2 and a molecular weight of 404.98 g/mol. Its IUPAC name is (5S,7S)-N'-[2-(1-adamantyl)acetyl]-3-chloroadamantane-1-carbohydrazide.
| Compound Name | (5S,7S)-N'-[2-(1-adamantyl)acetyl]-3-chloroadamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 23375813 |
| Molecular Formula | C23H33ClN2O2 |
| Molecular Weight | 404.98 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | (5S,7S)-N'-[2-(1-adamantyl)acetyl]-3-chloroadamantane-1-carbohydrazide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NNC(=O)C12C[C@@H]3C[C@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C23H33ClN2O2/c24-23-10-17-4-18(11-23)9-22(8-17,13-23)20(28)26-25-19(27)12-21-5-14-1-15(6-21)3-16(2-14)7-21/h14-18H,1-13H2,(H,25,27)(H,26,28)/t14?,15?,16?,17-,18-,21?,22?,23?/m0/s1 |
| InChIKey | VXLCJMTWQORQQB-ILXADSSFSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.98 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|