C15H24N2O2 — CID 24538351
N'-butanoyladamantane-1-carbohydrazide (PubChem CID 24538351) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-butanoyladamantane-1-carbohydrazide.
| Compound Name | N'-butanoyladamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 24538351 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-butanoyladamantane-1-carbohydrazide |
| SMILES | CCCC(=O)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24N2O2/c1-2-3-13(18)16-17-14(19)15-7-10-4-11(8-15)6-12(5-10)9-15/h10-12H,2-9H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | VFKIHNPVWGHBDN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|