C20H25FN2O2S — CID 7978661
N'-[3-(4-fluorophenyl)sulfanylpropanoyl]adamantane-1-carbohydrazide (PubChem CID 7978661) has the molecular formula C20H25FN2O2S and a molecular weight of 376.50 g/mol. Its IUPAC name is N'-[3-(4-fluorophenyl)sulfanylpropanoyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[3-(4-fluorophenyl)sulfanylpropanoyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 7978661 |
| Molecular Formula | C20H25FN2O2S |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N'-[3-(4-fluorophenyl)sulfanylpropanoyl]adamantane-1-carbohydrazide |
| SMILES | O=C(CCSc1ccc(F)cc1)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25FN2O2S/c21-16-1-3-17(4-2-16)26-6-5-18(24)22-23-19(25)20-10-13-7-14(11-20)9-15(8-13)12-20/h1-4,13-15H,5-12H2,(H,22,24)(H,23,25) |
| InChIKey | ZDCKZQVTLPXEPF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|