C23H30FNO3S — CID 7650953
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 7650953) has the molecular formula C23H30FNO3S and a molecular weight of 419.56 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7650953 |
| Molecular Formula | C23H30FNO3S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCSc1ccc(F)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H30FNO3S/c1-15(23-11-16-8-17(12-23)10-18(9-16)13-23)25-21(26)14-28-22(27)6-7-29-20-4-2-19(24)3-5-20/h2-5,15-18H,6-14H2,1H3,(H,25,26)/t15-,16?,17?,18?,23?/m0/s1 |
| InChIKey | IDIKWTJESZSMPK-SCUMNGBJSA-N |
| XLogP | 4.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |