C19H19F2NO3S — CID 42976650
[2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate (PubChem CID 42976650) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate.
| Compound Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 42976650 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | [2-[1-(4-fluorophenyl)ethylamino]-2-oxoethyl] 3-(4-fluorophenyl)sulfanylpropanoate |
| SMILES | CC(NC(=O)COC(=O)CCSc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H19F2NO3S/c1-13(14-2-4-15(20)5-3-14)22-18(23)12-25-19(24)10-11-26-17-8-6-16(21)7-9-17/h2-9,13H,10-12H2,1H3,(H,22,23) |
| InChIKey | ULTXFZAXTQYQDD-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |