C19H21NO3S — CID 16531163
[2-oxo-2-(1-phenylethylamino)ethyl] 3-phenylsulfanylpropanoate (PubChem CID 16531163) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 16531163 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | [2-oxo-2-(1-phenylethylamino)ethyl] 3-phenylsulfanylpropanoate |
| SMILES | CC(NC(=O)COC(=O)CCSc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO3S/c1-15(16-8-4-2-5-9-16)20-18(21)14-23-19(22)12-13-24-17-10-6-3-7-11-17/h2-11,15H,12-14H2,1H3,(H,20,21) |
| InChIKey | IYZDLVXYGXXVBL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |