C21H23NO3S — CID 55525250
[2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-phenylsulfanylpropanoate (PubChem CID 55525250) has the molecular formula C21H23NO3S and a molecular weight of 369.49 g/mol. Its IUPAC name is [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 55525250 |
| Molecular Formula | C21H23NO3S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [2-[[cyclopropyl(phenyl)methyl]amino]-2-oxoethyl] 3-phenylsulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccccc1)NC(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C21H23NO3S/c23-19(22-21(17-11-12-17)16-7-3-1-4-8-16)15-25-20(24)13-14-26-18-9-5-2-6-10-18/h1-10,17,21H,11-15H2,(H,22,23) |
| InChIKey | UZHVFLKADOMYGP-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |