C18H25NO3S — CID 55315732
[2-(cyclohexylmethylamino)-2-oxoethyl] 3-phenylsulfanylpropanoate (PubChem CID 55315732) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 55315732 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 3-phenylsulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccccc1)NCC1CCCCC1 |
| InChI | InChI=1S/C18H25NO3S/c20-17(19-13-15-7-3-1-4-8-15)14-22-18(21)11-12-23-16-9-5-2-6-10-16/h2,5-6,9-10,15H,1,3-4,7-8,11-14H2,(H,19,20) |
| InChIKey | BFOITSDXOJHBQM-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |