C17H23NO3 — CID 55319435
[2-(cyclohexylmethylamino)-2-oxoethyl] 2-phenylacetate (PubChem CID 55319435) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 2-phenylacetate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-phenylacetate |
|---|---|
| PubChem CID | 55319435 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-phenylacetate |
| SMILES | O=C(COC(=O)Cc1ccccc1)NCC1CCCCC1 |
| InChI | InChI=1S/C17H23NO3/c19-16(18-12-15-9-5-2-6-10-15)13-21-17(20)11-14-7-3-1-4-8-14/h1,3-4,7-8,15H,2,5-6,9-13H2,(H,18,19) |
| InChIKey | VGAMTQHUEJLMET-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |