About 2-phenylethyl N-(cyclopentylmethyl)carbamate
2-phenylethyl N-(cyclopentylmethyl)carbamate (PubChem CID 57081280) has the molecular formula C15H21NO2
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-phenylethyl N-(cyclopentylmethyl)carbamate.
Molecular Properties
| Compound Name | 2-phenylethyl N-(cyclopentylmethyl)carbamate |
| PubChem CID | 57081280 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 2-phenylethyl N-(cyclopentylmethyl)carbamate |
| SMILES | O=C(NCC1CCCC1)OCCc1ccccc1 |
| InChI | InChI=1S/C15H21NO2/c17-15(16-12-14-8-4-5-9-14)18-11-10-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,16,17) |
| InChIKey | NVLCWNIRARMOSD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-phenylethyl N-(cyclopentylmethyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl N-(cyclopentylmethyl)carbamate?
The IUPAC name of 2-phenylethyl N-(cyclopentylmethyl)carbamate (CID 57081280) is 2-phenylethyl N-(cyclopentylmethyl)carbamate.
What is the SMILES notation for 2-phenylethyl N-(cyclopentylmethyl)carbamate?
The canonical SMILES for 2-phenylethyl N-(cyclopentylmethyl)carbamate is O=C(NCC1CCCC1)OCCc1ccccc1.
What is the InChIKey of 2-phenylethyl N-(cyclopentylmethyl)carbamate?
The InChIKey is NVLCWNIRARMOSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NO2/c17-15(16-12-14-8-4-5-9-14)18-11-10-13-6-2-1-3-7-13/h1-3,6-7,14H,4-5,8-12H2,(H,16,17).
What are the key properties of 2-phenylethyl N-(cyclopentylmethyl)carbamate?
2-phenylethyl N-(cyclopentylmethyl)carbamate has a molecular weight of 247.34 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl N-(cyclopentylmethyl)carbamate is sourced from PubChem (CID 57081280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).