C16H23NO — CID 54313529
N-(cycloheptylmethyl)-2-phenylacetamide (PubChem CID 54313529) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is N-(cycloheptylmethyl)-2-phenylacetamide.
| Compound Name | N-(cycloheptylmethyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 54313529 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | N-(cycloheptylmethyl)-2-phenylacetamide |
| SMILES | O=C(Cc1ccccc1)NCC1CCCCCC1 |
| InChI | InChI=1S/C16H23NO/c18-16(12-14-8-6-3-7-9-14)17-13-15-10-4-1-2-5-11-15/h3,6-9,15H,1-2,4-5,10-13H2,(H,17,18) |
| InChIKey | HEMKXYCNUCVUHY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |