C19H23N3O4 — CID 7251515
[2-(cyclohexylmethylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7251515) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7251515 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [2-(cyclohexylmethylamino)-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | O=C(COC(=O)Cc1n[nH]c(=O)c2ccccc12)NCC1CCCCC1 |
| InChI | InChI=1S/C19H23N3O4/c23-17(20-11-13-6-2-1-3-7-13)12-26-18(24)10-16-14-8-4-5-9-15(14)19(25)22-21-16/h4-5,8-9,13H,1-3,6-7,10-12H2,(H,20,23)(H,22,25) |
| InChIKey | QHIFKSNNPHGVIV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |