C18H18N4O4 — CID 7251543
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate (PubChem CID 7251543) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
|---|---|
| PubChem CID | 7251543 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 2-(4-oxo-3H-phthalazin-1-yl)acetate |
| SMILES | N#CC1(NC(=O)COC(=O)Cc2n[nH]c(=O)c3ccccc23)CCCC1 |
| InChI | InChI=1S/C18H18N4O4/c19-11-18(7-3-4-8-18)20-15(23)10-26-16(24)9-14-12-5-1-2-6-13(12)17(25)22-21-14/h1-2,5-6H,3-4,7-10H2,(H,20,23)(H,22,25) |
| InChIKey | MKBIEUPCUNBOSH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |