C19H20N4O4 — CID 135831915
[2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135831915) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135831915 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | [2-[(1-cyanocyclopentyl)amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | N#CC1(NC(=O)COC(=O)CCc2nc3ccccc3c(=O)[nH]2)CCCC1 |
| InChI | InChI=1S/C19H20N4O4/c20-12-19(9-3-4-10-19)23-16(24)11-27-17(25)8-7-15-21-14-6-2-1-5-13(14)18(26)22-15/h1-2,5-6H,3-4,7-11H2,(H,23,24)(H,21,22,26) |
| InChIKey | KZABYXFRDYJMIG-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 124.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |