C20H19N3O4 — CID 135782994
(2-anilino-2-oxoethyl) 4-(4-oxo-3H-quinazolin-2-yl)butanoate (PubChem CID 135782994) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-anilino-2-oxoethyl) 4-(4-oxo-3H-quinazolin-2-yl)butanoate.
| Compound Name | (2-anilino-2-oxoethyl) 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
|---|---|
| PubChem CID | 135782994 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | (2-anilino-2-oxoethyl) 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
| SMILES | O=C(COC(=O)CCCc1nc2ccccc2c(=O)[nH]1)Nc1ccccc1 |
| InChI | InChI=1S/C20H19N3O4/c24-18(21-14-7-2-1-3-8-14)13-27-19(25)12-6-11-17-22-16-10-5-4-9-15(16)20(26)23-17/h1-5,7-10H,6,11-13H2,(H,21,24)(H,22,23,26) |
| InChIKey | XERZNDVNPFKFPL-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |