C19H25N3O4 — CID 135782918
[2-oxo-2-(pentan-3-ylamino)ethyl] 4-(4-oxo-3H-quinazolin-2-yl)butanoate (PubChem CID 135782918) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] 4-(4-oxo-3H-quinazolin-2-yl)butanoate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
|---|---|
| PubChem CID | 135782918 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 4-(4-oxo-3H-quinazolin-2-yl)butanoate |
| SMILES | CCC(CC)NC(=O)COC(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H25N3O4/c1-3-13(4-2)20-17(23)12-26-18(24)11-7-10-16-21-15-9-6-5-8-14(15)19(25)22-16/h5-6,8-9,13H,3-4,7,10-12H2,1-2H3,(H,20,23)(H,21,22,25) |
| InChIKey | VHZKOXKAGLRQSV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |