C19H19N3O5 — CID 135700118
[2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135700118) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135700118 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [2-[[(1R)-1-(furan-2-yl)ethyl]amino]-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | C[C@@H](NC(=O)COC(=O)CCc1nc2ccccc2c(=O)[nH]1)c1ccco1 |
| InChI | InChI=1S/C19H19N3O5/c1-12(15-7-4-10-26-15)20-17(23)11-27-18(24)9-8-16-21-14-6-3-2-5-13(14)19(25)22-16/h2-7,10,12H,8-9,11H2,1H3,(H,20,23)(H,21,22,25)/t12-/m1/s1 |
| InChIKey | ZSBRJWOBHZKTLR-GFCCVEGCSA-N |
| XLogP | 1.87 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |