C22H23N3O4 — CID 135831902
[2-oxo-2-(2,4,6-trimethylanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135831902) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135831902 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | [2-oxo-2-(2,4,6-trimethylanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | Cc1cc(C)c(NC(=O)COC(=O)CCc2nc3ccccc3c(=O)[nH]2)c(C)c1 |
| InChI | InChI=1S/C22H23N3O4/c1-13-10-14(2)21(15(3)11-13)25-19(26)12-29-20(27)9-8-18-23-17-7-5-4-6-16(17)22(28)24-18/h4-7,10-11H,8-9,12H2,1-3H3,(H,25,26)(H,23,24,28) |
| InChIKey | QZJXNECXFLJXEI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |