C21H21N3O6 — CID 135543298
[2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135543298) has the molecular formula C21H21N3O6 and a molecular weight of 411.41 g/mol. Its IUPAC name is [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135543298 |
| Molecular Formula | C21H21N3O6 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | [2-(2,4-dimethoxyanilino)-2-oxoethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | COc1ccc(NC(=O)COC(=O)CCc2nc3ccccc3c(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C21H21N3O6/c1-28-13-7-8-16(17(11-13)29-2)23-19(25)12-30-20(26)10-9-18-22-15-6-4-3-5-14(15)21(27)24-18/h3-8,11H,9-10,12H2,1-2H3,(H,23,25)(H,22,24,27) |
| InChIKey | FBKKXWNBALBKDC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |