C21H23N3O4 — CID 137303370
N-[(2,4-dimethoxyphenyl)methyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 137303370) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 137303370 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | COc1ccc(CNC(=O)CCCc2nc3ccccc3c(=O)[nH]2)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-27-15-11-10-14(18(12-15)28-2)13-22-20(25)9-5-8-19-23-17-7-4-3-6-16(17)21(26)24-19/h3-4,6-7,10-12H,5,8-9,13H2,1-2H3,(H,22,25)(H,23,24,26) |
| InChIKey | OJHGTCIOHXCZNI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |