C21H22N4O5 — CID 137007145
N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-(4-oxo-3H-quinazolin-2-yl)butanamide (PubChem CID 137007145) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-(4-oxo-3H-quinazolin-2-yl)butanamide.
| Compound Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
|---|---|
| PubChem CID | 137007145 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[(E)-(4-hydroxy-3,5-dimethoxyphenyl)methylideneamino]-4-(4-oxo-3H-quinazolin-2-yl)butanamide |
| SMILES | COc1cc(/C=N/NC(=O)CCCc2nc3ccccc3c(=O)[nH]2)cc(OC)c1O |
| InChI | InChI=1S/C21H22N4O5/c1-29-16-10-13(11-17(30-2)20(16)27)12-22-25-19(26)9-5-8-18-23-15-7-4-3-6-14(15)21(28)24-18/h3-4,6-7,10-12,27H,5,8-9H2,1-2H3,(H,25,26)(H,23,24,28)/b22-12+ |
| InChIKey | XWZSYKNVGDSQKO-WSDLNYQXSA-N |
| XLogP | 2.12 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|