C19H14F3N3O4 — CID 135831892
[2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135831892) has the molecular formula C19H14F3N3O4 and a molecular weight of 405.33 g/mol. Its IUPAC name is [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135831892 |
| Molecular Formula | C19H14F3N3O4 |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-oxo-2-(2,3,4-trifluoroanilino)ethyl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | O=C(COC(=O)CCc1nc2ccccc2c(=O)[nH]1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C19H14F3N3O4/c20-11-5-6-13(18(22)17(11)21)24-15(26)9-29-16(27)8-7-14-23-12-4-2-1-3-10(12)19(28)25-14/h1-6H,7-9H2,(H,24,26)(H,23,25,28) |
| InChIKey | RKHHNUWZGADPQT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|