C20H17F3N4O3 — CID 135675737
4-(4-oxo-3H-quinazolin-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide (PubChem CID 135675737) has the molecular formula C20H17F3N4O3 and a molecular weight of 418.38 g/mol. Its IUPAC name is 4-(4-oxo-3H-quinazolin-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide.
| Compound Name | 4-(4-oxo-3H-quinazolin-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide |
|---|---|
| PubChem CID | 135675737 |
| Molecular Formula | C20H17F3N4O3 |
| Molecular Weight | 418.38 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 4-(4-oxo-3H-quinazolin-2-yl)-N-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2c(=O)[nH]1)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C20H17F3N4O3/c21-12-8-9-14(19(23)18(12)22)26-17(29)10-24-16(28)7-3-6-15-25-13-5-2-1-4-11(13)20(30)27-15/h1-2,4-5,8-9H,3,6-7,10H2,(H,24,28)(H,26,29)(H,25,27,30) |
| InChIKey | QAVSAQPYCDXIHT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|