C15H21ClN4O2 — CID 137098154
N-(3-aminopropyl)-4-(4-oxo-3H-quinazolin-2-yl)butanamide;hydrochloride (PubChem CID 137098154) has the molecular formula C15H21ClN4O2 and a molecular weight of 324.81 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(4-oxo-3H-quinazolin-2-yl)butanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-4-(4-oxo-3H-quinazolin-2-yl)butanamide;hydrochloride |
|---|---|
| PubChem CID | 137098154 |
| Molecular Formula | C15H21ClN4O2 |
| Molecular Weight | 324.81 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-(3-aminopropyl)-4-(4-oxo-3H-quinazolin-2-yl)butanamide;hydrochloride |
| SMILES | Cl.NCCCNC(=O)CCCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O2.ClH/c16-9-4-10-17-14(20)8-3-7-13-18-12-6-2-1-5-11(12)15(21)19-13;/h1-2,5-6H,3-4,7-10,16H2,(H,17,20)(H,18,19,21);1H |
| InChIKey | BICSYSYQAUZWNE-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.81 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|