C15H20N4O2S — CID 137052603
N-(3-aminopropyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide (PubChem CID 137052603) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide.
| Compound Name | N-(3-aminopropyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 137052603 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-(3-aminopropyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide |
| SMILES | NCCCNC(=O)CCSCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O2S/c16-7-3-8-17-14(20)6-9-22-10-13-18-12-5-2-1-4-11(12)15(21)19-13/h1-2,4-5H,3,6-10,16H2,(H,17,20)(H,18,19,21) |
| InChIKey | BQRPZCOEMLGMPL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|