C20H23ClN4O2S — CID 137163124
N-(2-amino-2-phenylethyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide;hydrochloride (PubChem CID 137163124) has the molecular formula C20H23ClN4O2S and a molecular weight of 418.95 g/mol. Its IUPAC name is N-(2-amino-2-phenylethyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide;hydrochloride.
| Compound Name | N-(2-amino-2-phenylethyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 137163124 |
| Molecular Formula | C20H23ClN4O2S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | N-(2-amino-2-phenylethyl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide;hydrochloride |
| SMILES | Cl.NC(CNC(=O)CCSCc1nc2ccccc2c(=O)[nH]1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O2S.ClH/c21-16(14-6-2-1-3-7-14)12-22-19(25)10-11-27-13-18-23-17-9-5-4-8-15(17)20(26)24-18;/h1-9,16H,10-13,21H2,(H,22,25)(H,23,24,26);1H |
| InChIKey | PTRYEBLBZMGDRF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|