C18H26N4O2S — CID 137122486
N-(1-amino-4-methylpentan-2-yl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide (PubChem CID 137122486) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is N-(1-amino-4-methylpentan-2-yl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide.
| Compound Name | N-(1-amino-4-methylpentan-2-yl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 137122486 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-(1-amino-4-methylpentan-2-yl)-3-[(4-oxo-3H-quinazolin-2-yl)methylsulfanyl]propanamide |
| SMILES | CC(C)CC(CN)NC(=O)CCSCc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H26N4O2S/c1-12(2)9-13(10-19)20-17(23)7-8-25-11-16-21-15-6-4-3-5-14(15)18(24)22-16/h3-6,12-13H,7-11,19H2,1-2H3,(H,20,23)(H,21,22,24) |
| InChIKey | FACZFJFEKSINCC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|