C19H17F3N4O2 — CID 135516424
2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 135516424) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 135516424 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-2-26(9-15-23-13-6-4-3-5-11(13)19(28)25-15)10-16(27)24-14-8-7-12(20)17(21)18(14)22/h3-8H,2,9-10H2,1H3,(H,24,27)(H,23,25,28) |
| InChIKey | XQOFSJJIOLDCIA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|