C15H20N4O2 — CID 135824653
N-ethyl-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide (PubChem CID 135824653) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is N-ethyl-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide.
| Compound Name | N-ethyl-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 135824653 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | N-ethyl-2-[ethyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
| SMILES | CCNC(=O)CN(CC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-16-14(20)10-19(4-2)9-13-17-12-8-6-5-7-11(12)15(21)18-13/h5-8H,3-4,9-10H2,1-2H3,(H,16,20)(H,17,18,21) |
| InChIKey | ULCJTTFZJQIWNZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |