C18H25N5O3 — CID 135809146
2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(ethylcarbamoyl)acetamide (PubChem CID 135809146) has the molecular formula C18H25N5O3 and a molecular weight of 359.43 g/mol. Its IUPAC name is 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(ethylcarbamoyl)acetamide.
| Compound Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(ethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 135809146 |
| Molecular Formula | C18H25N5O3 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.20 |
| IUPAC Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(ethylcarbamoyl)acetamide |
| SMILES | CCCCN(CC(=O)NC(=O)NCC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C18H25N5O3/c1-3-5-10-23(12-16(24)22-18(26)19-4-2)11-15-20-14-9-7-6-8-13(14)17(25)21-15/h6-9H,3-5,10-12H2,1-2H3,(H,20,21,25)(H2,19,22,24,26) |
| InChIKey | IKIFLBWBGPMMNT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |