C20H29N5O3 — CID 135809160
N-[[(2S)-butan-2-yl]carbamoyl]-2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide (PubChem CID 135809160) has the molecular formula C20H29N5O3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-[[(2S)-butan-2-yl]carbamoyl]-2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide.
| Compound Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 135809160 |
| Molecular Formula | C20H29N5O3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-[[(2S)-butan-2-yl]carbamoyl]-2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]acetamide |
| SMILES | CCCCN(CC(=O)NC(=O)N[C@@H](C)CC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H29N5O3/c1-4-6-11-25(13-18(26)24-20(28)21-14(3)5-2)12-17-22-16-10-8-7-9-15(16)19(27)23-17/h7-10,14H,4-6,11-13H2,1-3H3,(H,22,23,27)(H2,21,24,26,28)/t14-/m0/s1 |
| InChIKey | MKBOGQJHHDEKKG-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |