C25H26N4O2 — CID 135892988
2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-naphthalen-2-ylacetamide (PubChem CID 135892988) has the molecular formula C25H26N4O2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-naphthalen-2-ylacetamide.
| Compound Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 135892988 |
| Molecular Formula | C25H26N4O2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-naphthalen-2-ylacetamide |
| SMILES | CCCCN(CC(=O)Nc1ccc2ccccc2c1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C25H26N4O2/c1-2-3-14-29(16-23-27-22-11-7-6-10-21(22)25(31)28-23)17-24(30)26-20-13-12-18-8-4-5-9-19(18)15-20/h4-13,15H,2-3,14,16-17H2,1H3,(H,26,30)(H,27,28,31) |
| InChIKey | AWBSZAIPMPSPFF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |