C20H22ClN5O2 — CID 135729541
2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2-chloro-3-pyridinyl)acetamide (PubChem CID 135729541) has the molecular formula C20H22ClN5O2 and a molecular weight of 399.88 g/mol. Its IUPAC name is 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2-chloro-3-pyridinyl)acetamide.
| Compound Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2-chloro-3-pyridinyl)acetamide |
|---|---|
| PubChem CID | 135729541 |
| Molecular Formula | C20H22ClN5O2 |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[butyl-[(4-oxo-3H-quinazolin-2-yl)methyl]amino]-N-(2-chloro-3-pyridinyl)acetamide |
| SMILES | CCCCN(CC(=O)Nc1cccnc1Cl)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H22ClN5O2/c1-2-3-11-26(13-18(27)24-16-9-6-10-22-19(16)21)12-17-23-15-8-5-4-7-14(15)20(28)25-17/h4-10H,2-3,11-13H2,1H3,(H,24,27)(H,23,25,28) |
| InChIKey | OXKNWGDSZUGAGM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|