C19H21ClN5O3+ — CID 135729544
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-(2-methoxyethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135729544) has the molecular formula C19H21ClN5O3+ and a molecular weight of 402.86 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-(2-methoxyethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-(2-methoxyethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135729544 |
| Molecular Formula | C19H21ClN5O3+ |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl]-(2-methoxyethyl)-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | COCC[NH+](CC(=O)Nc1cccnc1Cl)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C19H20ClN5O3/c1-28-10-9-25(12-17(26)23-15-7-4-8-21-18(15)20)11-16-22-14-6-3-2-5-13(14)19(27)24-16/h2-8H,9-12H2,1H3,(H,23,26)(H,22,24,27)/p+1 |
| InChIKey | WZUBEIDQZAGNCG-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|