C21H25N4O2+ — CID 135808183
ethyl-[2-(2-ethylanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135808183) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is ethyl-[2-(2-ethylanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | ethyl-[2-(2-ethylanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135808183 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | ethyl-[2-(2-ethylanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CCc1ccccc1NC(=O)C[NH+](CC)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C21H24N4O2/c1-3-15-9-5-7-11-17(15)23-20(26)14-25(4-2)13-19-22-18-12-8-6-10-16(18)21(27)24-19/h5-12H,3-4,13-14H2,1-2H3,(H,23,26)(H,22,24,27)/p+1 |
| InChIKey | HEORKOZJKNTVBR-UHFFFAOYSA-O |
| XLogP | 1.53 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |