C20H23N4O3+ — CID 135808785
ethyl-[2-(3-methoxyanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium (PubChem CID 135808785) has the molecular formula C20H23N4O3+ and a molecular weight of 367.43 g/mol. Its IUPAC name is ethyl-[2-(3-methoxyanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium.
| Compound Name | ethyl-[2-(3-methoxyanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 135808785 |
| Molecular Formula | C20H23N4O3+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | ethyl-[2-(3-methoxyanilino)-2-oxoethyl]-[(4-oxo-3H-quinazolin-2-yl)methyl]azanium |
| SMILES | CC[NH+](CC(=O)Nc1cccc(OC)c1)Cc1nc2ccccc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H22N4O3/c1-3-24(13-19(25)21-14-7-6-8-15(11-14)27-2)12-18-22-17-10-5-4-9-16(17)20(26)23-18/h4-11H,3,12-13H2,1-2H3,(H,21,25)(H,22,23,26)/p+1 |
| InChIKey | YEADEELYCRXHKB-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |