C19H17ClN4O4 — CID 135568679
[(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135568679) has the molecular formula C19H17ClN4O4 and a molecular weight of 400.82 g/mol. Its IUPAC name is [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135568679 |
| Molecular Formula | C19H17ClN4O4 |
| Molecular Weight | 400.82 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | [(2R)-1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | C[C@@H](OC(=O)CCc1nc2ccccc2c(=O)[nH]1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H17ClN4O4/c1-11(18(26)23-14-7-4-10-21-17(14)20)28-16(25)9-8-15-22-13-6-3-2-5-12(13)19(27)24-15/h2-7,10-11H,8-9H2,1H3,(H,23,26)(H,22,24,27)/t11-/m1/s1 |
| InChIKey | YLPISLPPQYSVNG-LLVKDONJSA-N |
| XLogP | 2.47 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|