C20H17ClN4O6 — CID 135414705
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate (PubChem CID 135414705) has the molecular formula C20H17ClN4O6 and a molecular weight of 444.83 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
|---|---|
| PubChem CID | 135414705 |
| Molecular Formula | C20H17ClN4O6 |
| Molecular Weight | 444.83 g/mol |
| Exact Mass | 444.08 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(4-oxo-3H-quinazolin-2-yl)propanoate |
| SMILES | CC(OC(=O)CCc1nc2ccccc2c(=O)[nH]1)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C20H17ClN4O6/c1-11(19(27)23-16-7-6-12(25(29)30)10-14(16)21)31-18(26)9-8-17-22-15-5-3-2-4-13(15)20(28)24-17/h2-7,10-11H,8-9H2,1H3,(H,23,27)(H,22,24,28) |
| InChIKey | UVCYNJJVBBYPMA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 144.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|