C19H17ClN2O7 — CID 55472033
[1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 55472033) has the molecular formula C19H17ClN2O7 and a molecular weight of 420.81 g/mol. Its IUPAC name is [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 55472033 |
| Molecular Formula | C19H17ClN2O7 |
| Molecular Weight | 420.81 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [1-(2-chloro-4-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc2c(c1)OCO2)C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H17ClN2O7/c1-11(19(24)21-15-5-4-13(22(25)26)9-14(15)20)29-18(23)7-3-12-2-6-16-17(8-12)28-10-27-16/h2,4-6,8-9,11H,3,7,10H2,1H3,(H,21,24) |
| InChIKey | MBTCWNPKSAKUNT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|