C25H23NO5 — CID 46661938
[1-oxo-1-(2-phenylanilino)propan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 46661938) has the molecular formula C25H23NO5 and a molecular weight of 417.46 g/mol. Its IUPAC name is [1-oxo-1-(2-phenylanilino)propan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 46661938 |
| Molecular Formula | C25H23NO5 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | [1-oxo-1-(2-phenylanilino)propan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H23NO5/c1-17(31-24(27)14-12-18-11-13-22-23(15-18)30-16-29-22)25(28)26-21-10-6-5-9-20(21)19-7-3-2-4-8-19/h2-11,13,15,17H,12,14,16H2,1H3,(H,26,28) |
| InChIKey | AWLQKDXCVFCYEO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |