C27H21NO7 — CID 46661756
[1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 46661756) has the molecular formula C27H21NO7 and a molecular weight of 471.47 g/mol. Its IUPAC name is [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 46661756 |
| Molecular Formula | C27H21NO7 |
| Molecular Weight | 471.47 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [1-[(9,10-dioxoanthracen-2-yl)amino]-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc2c(c1)OCO2)C(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C27H21NO7/c1-15(35-24(29)11-7-16-6-10-22-23(12-16)34-14-33-22)27(32)28-17-8-9-20-21(13-17)26(31)19-5-3-2-4-18(19)25(20)30/h2-6,8-10,12-13,15H,7,11,14H2,1H3,(H,28,32) |
| InChIKey | YTSKPNSHKBVTDG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|