C19H18N2O7 — CID 46666659
[1-(2-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate (PubChem CID 46666659) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
|---|---|
| PubChem CID | 46666659 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 3-(1,3-benzodioxol-5-yl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc2c(c1)OCO2)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N2O7/c1-12(19(23)20-14-4-2-3-5-15(14)21(24)25)28-18(22)9-7-13-6-8-16-17(10-13)27-11-26-16/h2-6,8,10,12H,7,9,11H2,1H3,(H,20,23) |
| InChIKey | AVSLGJLGHCTTKK-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|