C22H21NO3S — CID 8654468
[(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] 3-thiophen-3-ylpropanoate (PubChem CID 8654468) has the molecular formula C22H21NO3S and a molecular weight of 379.48 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] 3-thiophen-3-ylpropanoate.
| Compound Name | [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] 3-thiophen-3-ylpropanoate |
|---|---|
| PubChem CID | 8654468 |
| Molecular Formula | C22H21NO3S |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [(2R)-1-oxo-1-(2-phenylanilino)propan-2-yl] 3-thiophen-3-ylpropanoate |
| SMILES | C[C@@H](OC(=O)CCc1ccsc1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C22H21NO3S/c1-16(26-21(24)12-11-17-13-14-27-15-17)22(25)23-20-10-6-5-9-19(20)18-7-3-2-4-8-18/h2-10,13-16H,11-12H2,1H3,(H,23,25)/t16-/m1/s1 |
| InChIKey | OTHHKBSZWKFKMC-MRXNPFEDSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |